CAS 1190198-22-1

5-Fluorobenzo[b]thiophene-2-carbonyl chloride

Description:

5-Fluorobenzo[b]thiophene-2-carbonyl chloride is a chemical compound characterized by its unique structure, which includes a fluorinated benzo[b]thiophene moiety and an acyl chloride functional group. This compound typically exhibits a pale yellow to light brown appearance and is known for its reactivity, particularly due to the presence of the carbonyl chloride group, which can readily participate in nucleophilic substitution reactions. The fluorine atom enhances the compound's electrophilicity and can influence its biological activity, making it of interest in medicinal chemistry. Additionally, the presence of the thiophene ring contributes to its aromatic properties and potential electronic characteristics. This compound is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as an intermediate in various chemical reactions. Safety precautions are necessary when handling this compound, as it may be corrosive and harmful upon exposure.

Formula: C₉H₄ClFOS

InChI: InChI=1S/C9H4ClFOS/c10-9(12)8-4-5-3-6(11)1-2-7(5)13-8/h1-4H

InChI key: InChIKey=ZKGYNEVYYSCZJA-UHFFFAOYSA-N

SMILES: C(Cl)(=O)C=1SC=2C(C1)=CC(F)=CC2

Synonyms:

• Benzo[b]thiophene-2-carbonyl chloride, 5-fluoro-
• 5-Fluorobenzo[b]thiophene-2-carbonyl chloride