CymitQuimica logo

CAS 1190198-25-4

:

Methyl 5-bromo-1,6-dihydro-4-hydroxy-6-oxo-3-pyridinecarboxylate

Description:
Methyl 5-bromo-1,6-dihydro-4-hydroxy-6-oxo-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a bromine atom at the 5-position introduces significant reactivity, making it useful in various synthetic applications. The compound features a carboxylate group, which contributes to its acidic properties, and a hydroxyl group that can participate in hydrogen bonding, enhancing its solubility in polar solvents. The keto group at the 6-position indicates potential for tautomerization, which can influence its reactivity and stability. This compound may exhibit biological activity, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in the development of pharmaceuticals or agrochemicals. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, Methyl 5-bromo-1,6-dihydro-4-hydroxy-6-oxo-3-pyridinecarboxylate is a versatile compound with notable chemical properties.
Formula:C7H6BrNO4
InChI:InChI=1S/C7H6BrNO4/c1-13-7(12)3-2-9-6(11)4(8)5(3)10/h2H,1H3,(H2,9,10,11)
InChI key:InChIKey=MXEWVVROXOCIKD-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1C(O)=C(Br)C(=O)NC1
Synonyms:
  • Methyl 5-bromo-1,6-dihydro-4-hydroxy-6-oxo-3-pyridinecarboxylate
  • 3-Pyridinecarboxylic acid, 5-bromo-1,6-dihydro-4-hydroxy-6-oxo-, methyl ester
Found 2 products.