CymitQuimica logo

CAS 1190198-27-6

:

6-Bromobenzo[b]thiophene-2-carboxamide

Description:
6-Bromobenzo[b]thiophene-2-carboxamide is a chemical compound characterized by its unique structure, which includes a bromine atom attached to a benzo[b]thiophene ring and a carboxamide functional group. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as stability and potential for various chemical reactions. The presence of the bromine substituent can influence its reactivity, making it suitable for electrophilic substitution reactions. The carboxamide group contributes to its solubility in polar solvents and can participate in hydrogen bonding, affecting its physical properties and biological activity. Compounds like this are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their interesting electronic properties and biological activities. Additionally, the specific arrangement of atoms in 6-Bromobenzo[b]thiophene-2-carboxamide may lead to unique interactions in biological systems, making it a candidate for further research in medicinal chemistry.
Formula:C9H6BrNOS
InChI:InChI=1S/C9H6BrNOS/c10-6-2-1-5-3-8(9(11)12)13-7(5)4-6/h1-4H,(H2,11,12)
InChI key:InChIKey=GZBHJNHSMWCHEC-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=CC=2C(S1)=CC(Br)=CC2
Synonyms:
  • 6-Bromobenzo[b]thiophene-2-carboxamide
  • Benzo[b]thiophene-2-carboxamide, 6-bromo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.