CAS 1190198-29-8
:6-Bromo-8-nitro-4(1H)-quinolinone
Description:
6-Bromo-8-nitro-4(1H)-quinolinone is a synthetic organic compound characterized by its quinolinone structure, which features a bromine atom and a nitro group as substituents. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, reflecting its aromatic nature. The presence of the bromine and nitro groups can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the nitro group may impart certain biological activities, making this compound of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in the fields of pharmaceuticals, agrochemicals, and materials science. As with many quinolinone derivatives, it may also exhibit fluorescence properties, which can be useful in analytical applications. Safety and handling precautions should be observed due to the presence of halogen and nitro functionalities, which can pose health risks.
Formula:C9H5BrN2O3
InChI:InChI=1S/C9H5BrN2O3/c10-5-3-6-8(13)1-2-11-9(6)7(4-5)12(14)15/h1-4H,(H,11,13)
InChI key:InChIKey=UBZJYKXBOFHZEP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(Br)=C1)C(=O)C=CN2
Synonyms:- 6-Bromo-8-nitro-4(1H)-quinolinone
- 4(1H)-Quinolinone, 6-bromo-8-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
