
CAS 1190198-34-5
:Ethyl 6-bromo-1,2-dihydro-4-hydroxy-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate
Description:
Ethyl 6-bromo-1,2-dihydro-4-hydroxy-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate is a complex organic compound characterized by its naphthyridine core, which features a bromine substituent and various functional groups including a carboxylate ester and a hydroxyl group. This compound is likely to exhibit properties typical of naphthyridine derivatives, such as potential biological activity, including antimicrobial or anticancer effects, due to the presence of the heterocyclic structure. The ethyl ester group may enhance its solubility in organic solvents, making it suitable for various chemical reactions or applications in medicinal chemistry. Additionally, the presence of the phenylmethyl group could influence its electronic properties and reactivity. The compound's structure suggests it may participate in hydrogen bonding due to the hydroxyl group, which could affect its interactions in biological systems. Overall, this compound represents a class of molecules that may have significant pharmacological potential, warranting further investigation into its chemical behavior and biological activity.
Formula:C18H15BrN2O4
InChI:InChI=1S/C18H15BrN2O4/c1-2-25-18(24)14-15(22)13-8-12(19)9-20-16(13)21(17(14)23)10-11-6-4-3-5-7-11/h3-9,22H,2,10H2,1H3
InChI key:InChIKey=UOVURXKDFKMEGR-UHFFFAOYSA-N
SMILES:C(N1C=2C(C(O)=C(C(OCC)=O)C1=O)=CC(Br)=CN2)C3=CC=CC=C3
Synonyms:- Ethyl 6-bromo-1,2-dihydro-4-hydroxy-2-oxo-1-(phenylmethyl)-1,8-naphthyridine-3-carboxylate
- 1,8-Naphthyridine-3-carboxylic acid, 6-bromo-1,2-dihydro-4-hydroxy-2-oxo-1-(phenylmethyl)-, ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.