CAS 1190198-38-9
:4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-(trifluoromethyl)quinazoline
Description:
4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-(trifluoromethyl)quinazoline is a chemical compound characterized by its unique structural features, which include a quinazoline core and a hexahydro-1H-1,4-diazepine moiety. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit properties typical of heterocyclic compounds, such as potential pharmacological activity, making it of interest in medicinal chemistry. The hexahydro-1H-1,4-diazepine ring contributes to its cyclic structure, which can affect its reactivity and interaction with biological targets. Additionally, the trifluoromethyl group can enhance metabolic stability and alter the compound's electronic properties. Overall, this compound's characteristics suggest potential applications in drug development, particularly in areas targeting neurological or psychiatric disorders, although specific biological activities would require further investigation through experimental studies.
Formula:C14H15F3N4
InChI:InChI=1S/C14H15F3N4/c15-14(16,17)13-19-11-5-2-1-4-10(11)12(20-13)21-8-3-6-18-7-9-21/h1-2,4-5,18H,3,6-9H2
InChI key:InChIKey=PHKQYXUECQYYDB-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C=1N=C(C2=C(N1)C=CC=C2)N3CCCNCC3
Synonyms:- Quinazoline, 4-(hexahydro-1H-1,4-diazepin-1-yl)-2-(trifluoromethyl)-
- 4-(Hexahydro-1H-1,4-diazepin-1-yl)-2-(trifluoromethyl)quinazoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.