CAS 1190225-48-9: (2E)-1-[3-[(2R,4R)-3,4-Dihydro-7-hydroxy-5,8-dimethoxy-2-phenyl-2H-1-benzopyran-4-yl]-2,6-dihydroxy-4-methoxyphenyl]-3-phenyl-2-propen-1-one
Description:The chemical substance with the name "(2E)-1-[3-[(2R,4R)-3,4-Dihydro-7-hydroxy-5,8-dimethoxy-2-phenyl-2H-1-benzopyran-4-yl]-2,6-dihydroxy-4-methoxyphenyl]-3-phenyl-2-propen-1-one" and CAS number "1190225-48-9" is a complex organic compound characterized by its polyphenolic structure, which includes multiple aromatic rings and hydroxyl groups. This compound is likely to exhibit significant biological activity due to its structural features, which may contribute to antioxidant, anti-inflammatory, or anticancer properties. The presence of methoxy groups enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological targets. Additionally, the stereochemistry indicated by the (2R,4R) configuration suggests specific spatial arrangements that may affect its pharmacodynamics. As a synthetic or naturally derived compound, it may be of interest in medicinal chemistry and pharmacology, particularly in the development of therapeutic agents. Further studies would be necessary to elucidate its precise mechanisms of action and potential applications in health sciences.
Formula:C33H30O8
InChI:InChI=1S/C33H30O8/c1-38-26-17-23(35)30(22(34)15-14-19-10-6-4-7-11-19)31(37)28(26)21-16-25(20-12-8-5-9-13-20)41-33-29(21)27(39-2)18-24(36)32(33)40-3/h4-15,17-18,21,25,35-37H,16H2,1-3H3/b15-14+/t21-,25-/m1/s1
InChI key:InChIKey=VXTGJTRCSRGQGL-INGXWZIVSA-N
SMILES:O=C(C=CC=1C=CC=CC1)C2=C(O)C=C(OC)C(=C2O)C3C=4C(OC)=CC(O)=C(OC)C4OC(C=5C=CC=CC5)C3
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Sarcandrone B REF: BP-SBP01865CAS: 1190225-48-9 | 95%~99% | To inquire | Thu 06 Mar 25 |
![]() | Sarcandrone B REF: 3D-QXB22548CAS: 1190225-48-9 | Min. 95% | To inquire | Mon 14 Apr 25 |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Sarcandrone B
Ref: BP-SBP01865
Undefined size | To inquire |
![discount label](https://static.cymitquimica.com/public/img/discount.png)
Sarcandrone B
Ref: 3D-QXB22548
5mg | 809.00 € | ||
10mg | 1,218.00 € | ||
25mg | 2,283.00 € | ||
50mg | 3,652.00 € |