CAS 119023-25-5

Benzamide, 2-amino-4-fluoro- (9CI)

Description:

Benzamide, 2-amino-4-fluoro- (9CI), with the CAS number 119023-25-5, is an organic compound characterized by the presence of both an amine and a fluoro substituent on a benzamide structure. This compound features a benzene ring attached to a carbonyl group (amide) and an amino group at the second position, while a fluorine atom is substituted at the fourth position of the benzene ring. The presence of the amino group imparts basic properties, while the fluorine atom can influence the compound's reactivity and polarity. Benzamide derivatives are often studied for their biological activity, including potential pharmaceutical applications, due to their ability to interact with various biological targets. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its chemical properties, such as melting point, boiling point, and reactivity, can be influenced by the specific functional groups present and their positions on the aromatic ring. Overall, 2-amino-4-fluorobenzamide is of interest in both synthetic and medicinal chemistry.

Formula: C₇H₇FN₂O

InChI: InChI=1/C7H7FN2O/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H2,10,11)

SMILES: c1cc(c(cc1F)N)C(=N)O

Synonyms:

• 2-Amino-4-fluorobenzamide

Benzamide, 2-amino-4-fluoro-

CAS: 119023-25-5

Formula: C₇H₇FN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 154.1417

Ref: IN-DA000P2N

2-Amino-4-fluorobenzamide

CAS: 119023-25-5

2-Amino-4-fluorobenzamide

Purity: 98%

Molecular weight: 154.14g/mol

Ref: 54-PC404509

Afatinib Impurity 74

CAS: 119023-25-5

Formula: C₇H₇FN₂O

Molecular weight: 154.14

Ref: 4Z-A-111089

2-Amino-4-fluorobenzamide

CAS: 119023-25-5

2-Amino-4-fluorobenzamide is a catalyst that reacts with alcohols and cyclizes them to form quinazolinones. It has been shown to oxidize various alcohols including those with an electron-donating group, such as esters and nitro groups. 2-Amino-4-fluorobenzamide also reacts with electron-deficient alcohols, such as oximes and hydrazines. The mechanism of the oxidative cyclizations is not well understood but it is likely that they are initiated by a nucleophilic attack on the carbonyl carbon atom followed by a concerted or stepwise oxidation of the C=O double bond. The oxidative cyclization reactions are mechanistically similar to those of other catalytic oxidations, such as those used in the industrial production of acetic acid from methanol.

Formula: C₇H₇FN₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 154.14 g/mol

Ref: 3D-FA104622

2-Amino-4-fluorobenzamide

CAS: 119023-25-5

Formula: C₇H₇FN₂O

Purity: 97%

Color and Shape: Yellow powder

Molecular weight: 154.144

Ref: 10-F068084

Afatinib Impurity 74

CAS: 119023-25-5

Formula: C₇H₇FN₂O

Molecular weight: 154.14

Ref: ST-EA-CP-A50053