CAS 119023-25-5: Benzamide, 2-amino-4-fluoro- (9CI)

Description:Benzamide, 2-amino-4-fluoro- (9CI), with the CAS number 119023-25-5, is an organic compound characterized by the presence of both an amine and a fluoro substituent on a benzamide structure. This compound features a benzene ring attached to a carbonyl group (amide) and an amino group at the second position, while a fluorine atom is substituted at the fourth position of the benzene ring. The presence of the amino group imparts basic properties, while the fluorine atom can influence the compound's reactivity and polarity. Benzamide derivatives are often studied for their biological activity, including potential pharmaceutical applications, due to their ability to interact with various biological targets. The compound is typically solid at room temperature and may exhibit moderate solubility in polar solvents. Its chemical properties, such as melting point, boiling point, and reactivity, can be influenced by the specific functional groups present and their positions on the aromatic ring. Overall, 2-amino-4-fluorobenzamide is of interest in both synthetic and medicinal chemistry.

Formula:C₇H₇FN₂O

InChI:InChI=1/C7H7FN2O/c8-4-1-2-5(7(10)11)6(9)3-4/h1-3H,9H2,(H2,10,11)

Synonyms:
2-Amino-4-fluorobenzamide

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Benzamide, 2-amino-4-fluoro- REF: IN-DA000P2NCAS: 119023-25-5	98%	To inquire	Tue 25 Mar 25
2-Amino-4-fluorobenzamide REF: 54-PC404509CAS: 119023-25-5	95	49.00 €~1,183.00 €	Tue 01 Apr 25
Afatinib Impurity 74 REF: 4Z-A-111089CAS: 119023-25-5	- - -	To inquire	Tue 01 Apr 25
2-Amino-4-fluorobenzamide REF: 10-F068084CAS: 119023-25-5	97.0%	To inquire	Fri 04 Apr 25
2-Amino-4-fluorobenzamide REF: 3D-FA104622CAS: 119023-25-5	Min. 95%	127.00 €~1,229.00 €	Mon 07 Apr 25