CAS 119024-27-0
:2-(3,5-DICHLOROPHENOXY)ETHANETHIOAMIDE
Description:
2-(3,5-Dichlorophenoxy)ethanethioamide is a chemical compound characterized by its unique structure, which includes a dichlorophenyl group and a thioamide functional group. The presence of the dichlorophenyl moiety suggests that this compound may exhibit significant biological activity, potentially influencing its interactions with various biological targets. The thioamide group contributes to its reactivity and may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. This compound is likely to be a solid at room temperature, with moderate solubility in organic solvents, reflecting the hydrophobic nature of the chlorinated aromatic ring. Its chemical properties may include stability under standard conditions, but it could be sensitive to strong acids or bases. Additionally, the compound may have applications in agrochemicals or pharmaceuticals, given the presence of the phenoxy and thioamide functionalities, which are often associated with herbicidal or medicinal properties. Safety and handling precautions should be observed due to the potential toxicity associated with chlorinated compounds.
Formula:C8H7Cl2NOS
InChI:InChI=1/C8H7Cl2NOS/c9-5-1-6(10)3-7(2-5)12-4-8(11)13/h1-3H,4H2,(H2,11,13)
SMILES:c1c(cc(cc1Cl)OCC(=N)S)Cl
Synonyms:- 2-(3,5-Dichlorophenoxy)Thioacetamide
- 2-(3,5-Chlorophenoxy)thioacetamide, 97%
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
