CAS 1190309-71-7: 3-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridine

Description:3-Bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of bromine and fluorine substituents at the 3 and 5 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high lipophilicity due to its aromatic structure, which can influence its solubility in organic solvents. It may also display interesting biological activities, making it a candidate for pharmaceutical research. The molecular structure allows for potential interactions with biological targets, and its halogen substituents can affect electronic properties, such as electron density and polarity. Additionally, the compound's stability and reactivity can be influenced by the presence of these halogens, making it a subject of interest in synthetic chemistry and drug development. Overall, 3-bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold in medicinal chemistry.

Formula:C₇H₄BrFN₂

InChI:InChI=1S/C7H4BrFN2/c8-6-3-11-7-5(6)1-4(9)2-10-7/h1-3H,(H,10,11)

InChI key:InChIKey=CRDINLYNEISYHP-UHFFFAOYSA-N

SMILES:FC=1C=NC=2NC=C(Br)C2C1

Synonyms:
1H-Pyrrolo[2,3-b]pyridine, 3-bromo-5-fluoro-
3-Bromo-5-Fluoro-7-Azaindole
C-2448
Qc-3833
X6127

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Pyrrolo[2,3-b]pyridine, 3-bromo-5-fluoro- REF: IN-DA000P3ECAS: 1190309-71-7	98%	To inquire	Tue 04 Mar 25
3-Bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridine REF: 54-PC99875CAS: 1190309-71-7	0.95	96.00 €~1,986.00 €	Mon 03 Mar 25
3-BROMO-5-FLUORO-1H-PYRROLO[2,3-B]PYRIDINE REF: 10-F330652CAS: 1190309-71-7	95.0%	28.00 €~1,085.00 €	Wed 05 Mar 25
3-Bromo-5-fluoro-1H-pyrrolo[2,3-b]pyridine REF: 3D-QXB30971CAS: 1190309-71-7	Min. 95%	- - -	Discontinued product