CAS 1190309-73-9

4-Amino-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid

Description:

4-Amino-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The presence of these functional groups suggests that it may exhibit both basic and acidic properties, allowing it to participate in various chemical reactions, including those typical of amino acids. Its structure may confer biological activity, potentially making it of interest in pharmaceutical research. The compound is likely to be soluble in polar solvents due to the presence of the carboxylic acid group, while its heterocyclic nature may influence its reactivity and interaction with biological systems. Additionally, the specific arrangement of atoms in the pyrrolo[2,3-c]pyridine framework may affect its electronic properties, making it a candidate for further studies in medicinal chemistry and drug design. Overall, this compound represents a fascinating intersection of organic chemistry and potential therapeutic applications.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c9-5-2-10-3-6-7(5)4(1-11-6)8(12)13/h1-3,11H,9H2,(H,12,13)

InChI key: InChIKey=NPFHYCYFWQMKLL-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=CN=CC2N

Synonyms:

• 4-Amino-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
• 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 4-amino-

1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 4-amino-

CAS: 1190309-73-9

Formula: C₈H₇N₃O₂

Molecular weight: 177.1601

Ref: IN-DA000P3C