CymitQuimica logo

CAS 1190309-75-1

:

3-Bromo-4-fluoro-1H-pyrrolo[3,2-c]pyridine

Description:
3-Bromo-4-fluoro-1H-pyrrolo[3,2-c]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and a pyrrole ring. The presence of bromine and fluorine substituents introduces significant reactivity and influences its chemical properties, such as polarity and solubility. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions, although it can be sensitive to light and moisture. Its molecular structure allows for potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the halogen substituents can enhance its reactivity in various chemical reactions, making it a valuable intermediate in organic synthesis. As with many halogenated compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.
Formula:C7H4BrFN2
InChI:InChI=1S/C7H4BrFN2/c8-4-3-11-5-1-2-10-7(9)6(4)5/h1-3,11H
InChI key:InChIKey=KRJYDUOSUUVOOB-UHFFFAOYSA-N
SMILES:FC1=C2C(=CC=N1)NC=C2Br
Synonyms:
  • 1H-Pyrrolo[3,2-c]pyridine, 3-bromo-4-fluoro-
  • 3-Bromo-4-fluoro-1H-pyrrolo[3,2-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.