CymitQuimica logo

CAS 1190309-81-9

:

4-Nitro-1H-pyrrolo[2,3-c]pyridine

Description:
4-Nitro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, with a nitro group (-NO2) substituent at the 4-position of the pyrrole ring. This compound typically exhibits a pale yellow to brown solid appearance and is soluble in polar organic solvents. Its molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. The presence of the nitro group can influence its reactivity and interactions with biological targets. Additionally, 4-Nitro-1H-pyrrolo[2,3-c]pyridine may exhibit properties such as fluorescence or photostability, depending on its specific environment and conditions. As with many nitro-containing compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, this compound represents a valuable scaffold for further chemical modifications and investigations in various fields, including pharmaceuticals and agrochemicals.
Formula:C7H5N3O2
InChI:InChI=1S/C7H5N3O2/c11-10(12)7-4-8-3-6-5(7)1-2-9-6/h1-4,9H
InChI key:InChIKey=SMHSSEFMYGNOGP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(NC=C2)=CN=C1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 4-nitro-
  • 4-Nitro-1H-pyrrolo[2,3-c]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.