CAS 1190309-92-2

6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine

Description:

6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a nitro group at the 3-position enhances its reactivity and potential applications in medicinal chemistry and material science. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, making it suitable for various synthetic processes. Its molecular structure allows for potential interactions with biological targets, which may lead to pharmacological activity. The compound's reactivity can be attributed to the electron-withdrawing nature of the nitro group and the halogen, influencing its electrophilic and nucleophilic behavior. Additionally, its stability under standard laboratory conditions makes it a valuable intermediate in organic synthesis. Overall, 6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine is of interest for further research in drug development and chemical synthesis.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1S/C7H4ClN3O2/c8-6-2-1-4-5(11(12)13)3-9-7(4)10-6/h1-3H,(H,9,10)

InChI key: InChIKey=LHSQYXDNGXWWTK-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=NC(Cl)=CC2

Synonyms:

• 6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine
• 1H-Pyrrolo[2,3-b]pyridine, 6-chloro-3-nitro-

1H-Pyrrolo[2,3-b]pyridine, 6-chloro-3-nitro-

CAS: 1190309-92-2

Formula: C₇H₄ClN₃O₂

Purity: 95%

Molecular weight: 197.5786

Ref: IN-DA000P46

6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine

CAS: 1190309-92-2

6-Chloro-3-nitro-1H-pyrrolo[2,3-b]pyridine

Purity: 95%

Molecular weight: 197.58g/mol

Ref: 54-OR1046070