CymitQuimica logo

CAS 1190309-97-7

:

4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid

Description:
4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound features a nitro group (-NO2) and a carboxylic acid group (-COOH), which enhance its reactivity and solubility in polar solvents. The presence of the nitro group typically imparts electron-withdrawing characteristics, influencing the compound's acidity and reactivity in electrophilic substitution reactions. The carboxylic acid functionality allows for potential interactions in biological systems, making it of interest in medicinal chemistry. Additionally, the fused ring system provides structural rigidity, which can affect the compound's conformational stability and interactions with biological targets. Overall, 4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid is a compound of interest for research in pharmaceuticals and materials science due to its distinctive structural features and functional groups.
Formula:C8H5N3O4
InChI:InChI=1S/C8H5N3O4/c12-8(13)4-1-10-5-2-9-3-6(7(4)5)11(14)15/h1-3,10H,(H,12,13)
InChI key:InChIKey=IPZNMJPQKJUFGZ-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2C(NC1)=CN=CC2N(=O)=O
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine-3-carboxylic acid, 4-nitro-
  • 4-Nitro-1H-pyrrolo[2,3-c]pyridine-3-carboxylic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.