
CAS 1190309-99-9
:6-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine
Description:
6-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of a fluorine atom at the 6-position and an amino group at the 4-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. It is of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the pyrrolo-pyridine framework can influence pharmacological properties. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in synthetic organic chemistry. Safety data and handling precautions should be considered, as with any chemical substance, particularly in laboratory settings.
Formula:C7H6FN3
InChI:InChI=1S/C7H6FN3/c8-6-3-5(9)4-1-2-10-7(4)11-6/h1-3H,(H3,9,10,11)
InChI key:InChIKey=QKULTRQTLASLAB-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC(F)=C1)NC=C2
Synonyms:- 6-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine
- 1H-Pyrrolo[2,3-b]pyridin-4-amine, 6-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
