CymitQuimica logo

CAS 1190310-04-3

:

6-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde

Description:
6-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a fluorine atom at the 6-position enhances its reactivity and may influence its biological activity. The aldehyde functional group at the 4-position is significant for its potential applications in organic synthesis and medicinal chemistry, as it can participate in various reactions such as condensation and reduction. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential applications in the development of pharmaceuticals, particularly in targeting specific biological pathways due to the presence of the fluorine atom, which can modulate the compound's lipophilicity and bioavailability. Additionally, the compound's unique structural features may allow it to interact with biological targets, making it of interest in drug discovery and development. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity and reactivity.
Formula:C8H5FN2O
InChI:InChI=1S/C8H5FN2O/c9-7-3-5(4-12)6-1-2-10-8(6)11-7/h1-4H,(H,10,11)
InChI key:InChIKey=BSHGJCGQMBOWCX-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(=NC(F)=C1)NC=C2
Synonyms:
  • 6-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
  • 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 6-fluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.