CymitQuimica logo

CAS 1190310-08-7

:

5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine

Description:
5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 5-position and an amino group at the 4-position enhances its reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it a valuable intermediate in organic synthesis. Additionally, its specific molecular interactions can be explored for its role in drug design, particularly in targeting specific receptors or enzymes. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, influencing its behavior in different chemical environments.
Formula:C7H6FN3
InChI:InChI=1S/C7H6FN3/c8-5-3-11-7-4(6(5)9)1-2-10-7/h1-3H,(H3,9,10,11)
InChI key:InChIKey=JEGSNSPRVBYTDS-UHFFFAOYSA-N
SMILES:NC1=C2C(=NC=C1F)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridin-4-amine, 5-fluoro-
  • 5-Fluoro-1H-pyrrolo[2,3-b]pyridin-4-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.