CAS 1190310-09-8

7-Methyl-6-nitro-1H-pyrrolo[3,2-b]pyridine

Description:

7-Methyl-6-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyridine and pyrrole rings, which contribute to its unique chemical properties. The presence of a methyl group at the 7-position and a nitro group at the 6-position enhances its reactivity and potential applications in various chemical reactions. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it suitable for use in organic synthesis and medicinal chemistry. Its structure suggests potential biological activity, which may be explored in drug development or as a precursor in the synthesis of more complex molecules. The nitro group can participate in reduction reactions, while the pyrrolo-pyridine framework may interact with biological targets, indicating its relevance in pharmacology. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of interest in materials science and organic electronics. Safety and handling precautions should be observed due to the potential toxicity associated with nitro compounds.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c1-5-7(11(12)13)4-10-6-2-3-9-8(5)6/h2-4,9H,1H3

InChI key: InChIKey=MAZAFISQOPXSCZ-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC=C1N(=O)=O)C=CN2

Synonyms:

• 7-Methyl-6-nitro-1H-pyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 7-methyl-6-nitro-

1H-Pyrrolo[3,2-b]pyridine, 7-methyl-6-nitro-

CAS: 1190310-09-8

Formula: C₈H₇N₃O₂

Molecular weight: 177.1601

Ref: IN-DA000P3T