CymitQuimica logo

CAS 1190310-11-2

:

3-Amino-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid

Description:
3-Amino-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid is a heterocyclic organic compound characterized by its pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features an amino group and a carboxylic acid functional group, making it an amino acid derivative. The presence of these functional groups suggests that it may exhibit both basic and acidic properties, allowing it to participate in various chemical reactions, including peptide bond formation. Its structure indicates potential for biological activity, possibly serving as a building block in pharmaceuticals or as a ligand in coordination chemistry. The compound's solubility and stability can vary depending on the pH and solvent used, which is important for its application in biological systems. Additionally, its molecular framework may allow for interactions with biological targets, making it of interest in medicinal chemistry. Overall, 3-Amino-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid is a versatile compound with potential implications in drug development and biochemical research.
Formula:C8H7N3O2
InChI:InChI=1S/C8H7N3O2/c9-5-3-11-6-4(5)1-2-10-7(6)8(12)13/h1-3,11H,9H2,(H,12,13)
InChI key:InChIKey=UIVSIZDMRJKPPG-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(N)=CN2)=CC=N1
Synonyms:
  • 3-Amino-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid
  • 1H-Pyrrolo[2,3-c]pyridine-7-carboxylic acid, 3-amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.