CAS 1190310-15-6

5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde

Description:

5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a fluorine atom at the 5-position and an aldehyde functional group at the 4-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure allows for various chemical modifications, making it a valuable intermediate in the synthesis of pharmaceuticals and agrochemicals. The aldehyde group can participate in condensation reactions, while the fluorine atom can influence the compound's electronic properties and biological activity. Additionally, the compound's unique structural features may impart specific pharmacological properties, making it of interest in drug discovery and development. Safety and handling precautions should be observed due to the potential reactivity of the aldehyde group and the presence of fluorine.

Formula: C₈H₅FN₂O

InChI: InChI=1S/C8H5FN2O/c9-7-3-11-8-5(1-2-10-8)6(7)4-12/h1-4H,(H,10,11)

InChI key: InChIKey=QILHLWLSZHECBY-UHFFFAOYSA-N

SMILES: C(=O)C1=C2C(=NC=C1F)NC=C2

Synonyms:

• 5-Fluoro-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
• 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 5-fluoro-

1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 5-fluoro-

CAS: 1190310-15-6

Formula: C₈H₅FN₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 164.1365

Ref: IN-DA000P3P