CAS 1190310-17-8

3-Chloro-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid

Description:

3-Chloro-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. The presence of a chlorine atom at the 3-position and a carboxylic acid functional group at the 7-position enhances its reactivity and solubility in polar solvents. This compound typically exhibits moderate to high stability under standard conditions but may be sensitive to strong bases or nucleophiles due to the electrophilic nature of the chlorine atom. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry and drug development. The compound may also participate in various chemical reactions, such as nucleophilic substitution or coupling reactions, due to the functional groups present. Additionally, its unique structure may impart specific optical or electronic properties, which could be explored in materials science applications. Overall, 3-Chloro-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₈H₅ClN₂O₂

InChI: InChI=1S/C8H5ClN2O2/c9-5-3-11-6-4(5)1-2-10-7(6)8(12)13/h1-3,11H,(H,12,13)

InChI key: InChIKey=ZUJZXEJJEIBKQN-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(Cl)=CN2)=CC=N1

Synonyms:

• 3-Chloro-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid
• 1H-Pyrrolo[2,3-c]pyridine-7-carboxylic acid, 3-chloro-

1H-Pyrrolo[2,3-c]pyridine-7-carboxylic acid, 3-chloro-

CAS: 1190310-17-8

Formula: C₈H₅ClN₂O₂

Molecular weight: 196.5905

Ref: IN-DA000P3O