CymitQuimica logo

CAS 1190310-25-8

:

4-Bromo-1,3-dihydro-6-methoxy-2H-pyrrolo[2,3-b]pyridin-2-one

Description:
4-Bromo-1,3-dihydro-6-methoxy-2H-pyrrolo[2,3-b]pyridin-2-one is a heterocyclic organic compound characterized by its complex bicyclic structure, which includes a pyrrolopyridine framework. The presence of a bromine atom at the 4-position and a methoxy group at the 6-position contributes to its unique chemical properties and potential reactivity. This compound is likely to exhibit moderate to high lipophilicity due to its aromatic and aliphatic components, which may influence its solubility in organic solvents. The dihydro form indicates that it may exist in a partially saturated state, affecting its stability and reactivity. Additionally, the presence of functional groups such as the methoxy and carbonyl groups suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its CAS number, 1190310-25-8, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H7BrN2O2
InChI:InChI=1S/C8H7BrN2O2/c1-13-7-3-5(9)4-2-6(12)10-8(4)11-7/h3H,2H2,1H3,(H,10,11,12)
InChI key:InChIKey=IEYUIEZLIRKBGH-UHFFFAOYSA-N
SMILES:BrC1=C2C(=NC(OC)=C1)NC(=O)C2
Synonyms:
  • 4-Bromo-1,3-dihydro-6-methoxy-2H-pyrrolo[2,3-b]pyridin-2-one
  • 2H-Pyrrolo[2,3-b]pyridin-2-one, 4-bromo-1,3-dihydro-6-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.