CymitQuimica logo

CAS 1190310-28-1

:

3-Iodo-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid

Description:
3-Iodo-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its unique pyrrolopyridine structure, which features a fused pyrrole and pyridine ring system. The presence of an iodine atom at the 3-position and a carboxylic acid functional group at the 7-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often key components in drug design. The iodine substituent may also enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the compound's unique structural features may allow for various synthetic modifications, making it a valuable intermediate in organic synthesis. As with many heterocycles, it may exhibit interesting electronic properties and reactivity patterns, warranting further investigation in both synthetic and applied chemistry contexts.
Formula:C8H5IN2O2
InChI:InChI=1S/C8H5IN2O2/c9-5-3-11-6-4(5)1-2-10-7(6)8(12)13/h1-3,11H,(H,12,13)
InChI key:InChIKey=OUNREHGUQAQGHR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C2C(C(I)=CN2)=CC=N1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine-7-carboxylic acid, 3-iodo-
  • 3-Iodo-1H-pyrrolo[2,3-c]pyridine-7-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.