CymitQuimica logo

CAS 1190310-42-9

:

4-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine

Description:
4-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both nitrogen and iodine atoms. This compound features an iodine substituent at the 4-position and a methoxy group at the 6-position of the pyrrole ring, contributing to its chemical reactivity and potential biological activity. The presence of the methoxy group enhances its lipophilicity, which may influence its solubility and interaction with biological membranes. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its heterocyclic nature may also impart interesting electronic properties, making it a candidate for further research in organic synthesis and material science. As with many halogenated compounds, the iodine atom can play a significant role in the compound's reactivity, potentially participating in nucleophilic substitution reactions. Overall, 4-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C8H7IN2O
InChI:InChI=1S/C8H7IN2O/c1-12-7-4-6(9)5-2-3-10-8(5)11-7/h2-4H,1H3,(H,10,11)
InChI key:InChIKey=OPLFMPODYFIOAX-UHFFFAOYSA-N
SMILES:IC1=C2C(=NC(OC)=C1)NC=C2
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine, 4-iodo-6-methoxy-
  • 4-Iodo-6-methoxy-1H-pyrrolo[2,3-b]pyridine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.