CymitQuimica logo

CAS 1190310-58-7

:

5-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine

Description:
5-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and a pyridine ring fused together. The presence of a chlorine atom at the 5-position and an amino group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The compound may also participate in various chemical reactions, such as nucleophilic substitutions or coupling reactions, making it of interest for synthetic organic chemistry. Additionally, its specific properties, such as melting point, boiling point, and spectral characteristics, would be determined through experimental methods and could vary based on purity and environmental conditions.
Formula:C7H6ClN3
InChI:InChI=1S/C7H6ClN3/c8-7-1-4-5(9)2-10-6(4)3-11-7/h1-3,10H,9H2
InChI key:InChIKey=VIFNICDGFWEPFJ-UHFFFAOYSA-N
SMILES:NC=1C=2C(=CN=C(Cl)C2)NC1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridin-3-amine, 5-chloro-
  • 5-Chloro-1H-pyrrolo[2,3-c]pyridin-3-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.