CymitQuimica logo

CAS 1190310-68-9

:

4-Fluoro-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one

Description:
4-Fluoro-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a fluorine atom at the 4-position contributes to its reactivity and potential biological activity. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents, which is common for many nitrogen-containing heterocycles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can interact with biological targets. The compound may also display interesting electronic properties owing to the conjugated system formed by the nitrogen atoms and the aromatic character of the pyridine ring. Additionally, its synthesis and characterization are of interest in organic chemistry, particularly in the context of developing new synthetic methodologies or exploring its reactivity in various chemical transformations.
Formula:C7H5FN2O
InChI:InChI=1S/C7H5FN2O/c8-5-2-9-3-6-4(5)1-7(11)10-6/h2-3H,1H2,(H,10,11)
InChI key:InChIKey=YVGMRSFTRRCISC-UHFFFAOYSA-N
SMILES:FC1=C2C(NC(=O)C2)=CN=C1
Synonyms:
  • 2H-Pyrrolo[2,3-c]pyridin-2-one, 4-fluoro-1,3-dihydro-
  • 4-Fluoro-1,3-dihydro-2H-pyrrolo[2,3-c]pyridin-2-one
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.