CAS 1190310-73-6

3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid

Description:

3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid is a heterocyclic compound characterized by its unique bicyclic structure, which incorporates both a pyrrole and a pyridine ring. The presence of an iodine atom at the 3-position of the pyrrole ring contributes to its reactivity and potential applications in medicinal chemistry. The carboxylic acid functional group at the 7-position enhances its solubility in polar solvents and allows for potential interactions in biological systems. This compound may exhibit interesting biological activities, making it a candidate for further research in drug development. Its molecular structure suggests potential for various chemical modifications, which could lead to derivatives with enhanced properties. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the iodine substituent and the carboxylic acid group. Overall, 3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid represents a valuable scaffold in organic synthesis and pharmaceutical research.

Formula: C₈H₅IN₂O₂

InChI: InChI=1S/C8H5IN2O2/c9-5-3-11-6-4(8(12)13)1-2-10-7(5)6/h1-3,11H,(H,12,13)

InChI key: InChIKey=JLODAQGNZNIDCG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(C(I)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid, 3-iodo-
• 3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid

1H-Pyrrolo[3,2-b]pyridine-7-carboxylic acid, 3-iodo-

CAS: 1190310-73-6

Formula: C₈H₅IN₂O₂

Purity: 98%

Molecular weight: 288.0420

Ref: IN-DA000HH0

3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid

CAS: 1190310-73-6

3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid

Purity: 98%

Molecular weight: 288.04g/mol

Ref: 54-OR1034193

3-Iodo-1H-pyrrolo[3,2-b]pyridine-7-carboxylic acid

CAS: 1190310-73-6

Purity: 98%

Molecular weight: 288.0440063

Ref: 10-F734851