
CAS 1190310-80-5
:3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine
Description:
3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of a chlorine atom and a nitro group at specific positions on the pyrrolo ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocycles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting electronic properties owing to the conjugated system formed by the nitrogen-containing rings. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine represents a compound of interest in both synthetic and applied chemistry contexts.
Formula:C7H4ClN3O2
InChI:InChI=1S/C7H4ClN3O2/c8-4-3-10-7-5(11(12)13)1-2-9-6(4)7/h1-3,10H
InChI key:InChIKey=UYYLZINGRBKZEO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(C(Cl)=CN2)=NC=C1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 3-chloro-7-nitro-
- 3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
