CAS 1190310-80-5

3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine

Description:

3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyridine and a pyrrole moiety. The presence of a chlorine atom and a nitro group at specific positions on the pyrrolo ring contributes to its chemical reactivity and potential biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocycles. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of functional groups that can participate in various chemical reactions. Additionally, the compound may exhibit interesting electronic properties owing to the conjugated system formed by the nitrogen-containing rings. Safety data and handling precautions should be considered, as with any chemical substance, particularly regarding its potential toxicity and environmental impact. Overall, 3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine represents a compound of interest in both synthetic and applied chemistry contexts.

Formula: C₇H₄ClN₃O₂

InChI: InChI=1S/C7H4ClN3O2/c8-4-3-10-7-5(11(12)13)1-2-9-6(4)7/h1-3,10H

InChI key: InChIKey=UYYLZINGRBKZEO-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(C(Cl)=CN2)=NC=C1

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine, 3-chloro-7-nitro-
• 3-Chloro-7-nitro-1H-pyrrolo[3,2-b]pyridine

1H-Pyrrolo[3,2-b]pyridine, 3-chloro-7-nitro-

CAS: 1190310-80-5

Formula: C₇H₄ClN₃O₂

Molecular weight: 197.5786

Ref: IN-DA000HGW