CymitQuimica logo

CAS 1190310-86-1

:

4-Methyl 1H-pyrrolo[2,3-b]pyridine-3,4-dicarboxylate

Description:
4-Methyl 1H-pyrrolo[2,3-b]pyridine-3,4-dicarboxylate is a heterocyclic organic compound characterized by its pyrrole and pyridine ring structures, which contribute to its unique chemical properties. This compound features two carboxylate groups, enhancing its reactivity and potential for forming various derivatives. The presence of the methyl group at the 4-position of the pyrrole ring influences its electronic properties and steric hindrance, which can affect its interactions in chemical reactions. Typically, compounds of this nature exhibit moderate solubility in polar solvents due to their polar functional groups, while their aromatic nature may confer stability and potential for π-π stacking interactions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its synthesis often involves multi-step organic reactions, and it can serve as a building block for more complex molecules. As with many heterocycles, the specific reactivity and applications can vary widely based on the functional groups present and the overall molecular structure.
Formula:C10H8N2O4
InChI:InChI=1S/C10H8N2O4/c1-16-10(15)5-2-3-11-8-7(5)6(4-12-8)9(13)14/h2-4H,1H3,(H,11,12)(H,13,14)
InChI key:InChIKey=BKYCYFVXFDSWAI-UHFFFAOYSA-N
SMILES:C(OC)(=O)C1=C2C(NC=C2C(O)=O)=NC=C1
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3,4-dicarboxylic acid, 4-methyl ester
  • 4-Methyl 1H-pyrrolo[2,3-b]pyridine-3,4-dicarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.