CAS 1190310-95-2

2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

Description:

2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which consists of a fused pyrrole and pyridine ring system. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of a keto group enhances its reactivity, making it a potential candidate for various chemical transformations. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid group. The compound's unique structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets due to its ability to form hydrogen bonds and participate in π-π stacking interactions. Additionally, its structural features may confer specific biological activities, making it of interest for further research in drug discovery and development. As with many heterocycles, the compound's stability and reactivity can be influenced by substituents and environmental conditions.

Formula: C₈H₆N₂O₃

InChI: InChI=1S/C8H6N2O3/c11-6-3-5-4(8(12)13)1-2-9-7(5)10-6/h1-2H,3H2,(H,12,13)(H,9,10,11)

InChI key: InChIKey=KLFGKBLJFXZSJO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C2C(NC(=O)C2)=NC=C1

Synonyms:

• 2,3-Dihydro-2-oxo-1H-pyrrolo[2,3-b]pyridine-4-carboxylic acid
• 1H-Pyrrolo[2,3-b]pyridine-4-carboxylic acid, 2,3-dihydro-2-oxo-

2-oxo-1H,2H,3H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

CAS: 1190310-95-2

Formula: C₈H₆N₂O₃

Molecular weight: 178.1448

Ref: IN-DA000HGN

2-Oxo-1H,2H,3H-pyrrolo[2,3-b]pyridine-4-carboxylic acid

CAS: 1190310-95-2

Versatile small molecule scaffold

Formula: C₈H₆N₂O₃

Purity: Min. 95%

Molecular weight: 178.14 g/mol

Ref: 3D-QXB31095