
CAS 1190310-97-4
:1H-Pyrrolo[3,2-b]pyridine-3,7-diamine
Description:
1H-Pyrrolo[3,2-b]pyridine-3,7-diamine, identified by its CAS number 1190310-97-4, is a heterocyclic organic compound featuring a fused pyrrole and pyridine structure. This compound is characterized by the presence of amino groups at the 3 and 7 positions of the pyrrolo-pyridine framework, which can influence its reactivity and potential applications in medicinal chemistry. The molecular structure contributes to its potential as a pharmacophore in drug development, particularly in targeting various biological pathways. It may exhibit properties such as moderate solubility in polar solvents and stability under standard laboratory conditions. The presence of the amino groups can facilitate hydrogen bonding and enhance interactions with biological targets, making it a candidate for further investigation in therapeutic contexts. Additionally, its unique structure may allow for the exploration of derivatives that could optimize its biological activity or selectivity. Overall, 1H-Pyrrolo[3,2-b]pyridine-3,7-diamine represents a compound of interest in the field of organic and medicinal chemistry.
Formula:C7H8N4
InChI:InChI=1S/C7H8N4/c8-4-1-2-10-7-5(9)3-11-6(4)7/h1-3,11H,9H2,(H2,8,10)
InChI key:InChIKey=GQDAOFKFKOYIGL-UHFFFAOYSA-N
SMILES:NC1=C2C(C(N)=CN2)=NC=C1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine-3,7-diamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
