CymitQuimica logo

CAS 1190311-12-6

:

3-Iodo-1H-pyrrolo[3,2-b]pyridin-7-amine

Description:
3-Iodo-1H-pyrrolo[3,2-b]pyridin-7-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which consists of a pyrrole and pyridine fused together. The presence of an iodine atom at the 3-position and an amino group at the 7-position contributes to its reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential for interactions with biological targets, making it of interest in drug discovery and development. The iodine substituent can enhance the compound's lipophilicity and may influence its pharmacokinetic properties. Additionally, the presence of the amino group allows for further functionalization, which can be exploited in synthetic chemistry. As with many heterocycles, the compound may exhibit interesting electronic properties, making it a candidate for studies in materials science and organic electronics. Safety and handling precautions should be observed due to the presence of iodine and the potential biological activity of the compound.
Formula:C7H6IN3
InChI:InChI=1S/C7H6IN3/c8-4-3-11-7-5(9)1-2-10-6(4)7/h1-3,11H,(H2,9,10)
InChI key:InChIKey=DYNTVFWTIIERSJ-UHFFFAOYSA-N
SMILES:NC1=C2C(C(I)=CN2)=NC=C1
Synonyms:
  • 1H-Pyrrolo[3,2-b]pyridin-7-amine, 3-iodo-
  • 3-Iodo-1H-pyrrolo[3,2-b]pyridin-7-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.