CymitQuimica logo

CAS 1190311-17-1

:

7-Bromo-3-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine

Description:
7-Bromo-3-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine is a heterocyclic organic compound characterized by its complex ring structure, which includes both nitrogen and halogen substituents. The presence of bromine, chlorine, and fluorine atoms contributes to its unique reactivity and potential applications in medicinal chemistry and material science. This compound features a pyrrolopyridine framework, which is known for its biological activity, making it of interest in drug discovery. The halogen substituents can influence the compound's electronic properties, solubility, and interaction with biological targets. Additionally, the specific arrangement of these substituents can affect its pharmacokinetics and pharmacodynamics. As with many halogenated compounds, it may exhibit distinct properties such as increased lipophilicity and altered metabolic pathways. Safety and handling considerations are essential due to the presence of halogens, which can pose environmental and health risks. Overall, 7-Bromo-3-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine represents a valuable compound for further research and development in various chemical and pharmaceutical applications.
Formula:C7H3BrClFN2
InChI:InChI=1S/C7H3BrClFN2/c8-7-6-5(3(9)1-11-6)4(10)2-12-7/h1-2,11H
InChI key:InChIKey=RKGNNQRQTYJBTJ-UHFFFAOYSA-N
SMILES:BrC1=C2C(C(Cl)=CN2)=C(F)C=N1
Synonyms:
  • 1H-Pyrrolo[2,3-c]pyridine, 7-bromo-3-chloro-4-fluoro-
  • 7-Bromo-3-chloro-4-fluoro-1H-pyrrolo[2,3-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.