CAS 1190311-22-8

1H-Pyrrolo[3,2-b]pyridine-3,5-dicarboxylic acid

Description:

1H-Pyrrolo[3,2-b]pyridine-3,5-dicarboxylic acid, identified by its CAS number 1190311-22-8, is a heterocyclic organic compound featuring a fused pyrrole and pyridine structure. This compound is characterized by the presence of two carboxylic acid functional groups located at the 3 and 5 positions of the pyrrolo-pyridine framework. It typically exhibits properties such as solubility in polar solvents, which is common for carboxylic acids, and may display acidic behavior due to the presence of the carboxyl groups. The compound's unique structure contributes to its potential biological activity, making it of interest in medicinal chemistry and drug development. Additionally, its molecular configuration may influence its reactivity and interactions with other chemical entities. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the reaction conditions. Overall, this compound represents a fascinating area of study within organic and medicinal chemistry.

Formula: C₉H₆N₂O₄

InChI: InChI=1S/C9H6N2O4/c12-8(13)4-3-10-5-1-2-6(9(14)15)11-7(4)5/h1-3,10H,(H,12,13)(H,14,15)

InChI key: InChIKey=GTPJOBQIMPIFAZ-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=CC=C(C(O)=O)N2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine-3,5-dicarboxylic acid

1H-Pyrrolo[3,2-b]pyridine-3,5-dicarboxylic acid

CAS: 1190311-22-8

Formula: C₉H₆N₂O₄

Molecular weight: 206.1549

Ref: IN-DA000HHN