CymitQuimica logo

CAS 1190311-38-6

:

3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile

Description:
3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine rings. The presence of a chlorine atom at the 3-position and a cyano group at the 5-position contributes to its chemical reactivity and potential applications in medicinal chemistry. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its molecular structure suggests potential interactions with biological targets, making it of interest in drug discovery and development. The cyano group can participate in nucleophilic addition reactions, while the chlorine atom may serve as a leaving group in substitution reactions. Additionally, the compound's heteroatoms can influence its electronic properties, potentially enhancing its biological activity. Overall, 3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile is a versatile compound with implications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H4ClN3
InChI:InChI=1S/C8H4ClN3/c9-6-4-11-7-2-1-5(3-10)12-8(6)7/h1-2,4,11H
InChI key:InChIKey=DRJLHWVSIWXWDE-UHFFFAOYSA-N
SMILES:ClC=1C=2C(=CC=C(C#N)N2)NC1
Synonyms:
  • 3-Chloro-1H-pyrrolo[3,2-b]pyridine-5-carbonitrile
  • 1H-Pyrrolo[3,2-b]pyridine-5-carbonitrile, 3-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.