
CAS 1190311-43-3
:Methyl 2-bromo-4-methyl-6-benzothiazolecarboxylate
Description:
Methyl 2-bromo-4-methyl-6-benzothiazolecarboxylate is a chemical compound characterized by its unique structure, which includes a benzothiazole moiety, a bromine atom, and a carboxylate functional group. This compound typically appears as a solid or liquid, depending on its purity and environmental conditions. It is known for its potential applications in organic synthesis and medicinal chemistry, particularly due to the presence of the bromine atom, which can facilitate various chemical reactions, including nucleophilic substitutions. The benzothiazole ring contributes to its aromatic properties, which can influence its reactivity and interactions with biological systems. Additionally, the methyl ester group enhances its solubility in organic solvents, making it useful in various chemical processes. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, Methyl 2-bromo-4-methyl-6-benzothiazolecarboxylate is a compound of interest in research and development within the fields of chemistry and pharmacology.
Formula:C10H8BrNO2S
InChI:InChI=1S/C10H8BrNO2S/c1-5-3-6(9(13)14-2)4-7-8(5)12-10(11)15-7/h3-4H,1-2H3
InChI key:InChIKey=XSEAGAYSAHNOQI-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC(C(OC)=O)=C1)SC(Br)=N2
Synonyms:- Methyl 2-bromo-4-methyl-1,3-benzothiazole-6-carboxylate
- Methyl 2-bromo-4-methyl-6-benzothiazolecarboxylate
- 6-Benzothiazolecarboxylic acid, 2-bromo-4-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Methyl 2-bromo-4-methylbenzo[d]thiazole-6-carboxylate
CAS:Formula:C10H8BrNO2SMolecular weight:286.1450
