CAS 1190311-46-6

3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid

Description:

3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a pyrrole and a pyridine ring. The presence of a nitro group at the 3-position and a carboxylic acid group at the 5-position contributes to its chemical reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the carboxylic acid functionality. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the pyrrolopyridine framework is often associated with various biological activities. Additionally, the nitro group can serve as a handle for further chemical modifications. The compound's CAS number, 1190311-46-6, allows for precise identification in chemical databases, facilitating research and development efforts. Overall, 3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid is of interest for its unique structural features and potential applications in drug discovery.

Formula: C₈H₅N₃O₄

InChI: InChI=1S/C8H5N3O4/c12-8(13)5-2-1-4-7(10-5)6(3-9-4)11(14)15/h1-3,9H,(H,12,13)

InChI key: InChIKey=CMBNUIXGRASMAR-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CC=C(C(O)=O)N2

Synonyms:

• 3-Nitro-1H-pyrrolo[3,2-b]pyridine-5-carboxylic acid
• 1H-Pyrrolo[3,2-b]pyridine-5-carboxylic acid, 3-nitro-

1H-Pyrrolo[3,2-b]pyridine-5-carboxylic acid, 3-nitro-

CAS: 1190311-46-6

Formula: C₈H₅N₃O₄

Molecular weight: 207.143

Ref: IN-DA000HH9