CAS 1190311-52-4
:4-Methoxy-1H-pyrrolo[2,3-b]pyridin-6-amine
Description:
4-Methoxy-1H-pyrrolo[2,3-b]pyridin-6-amine is a heterocyclic organic compound characterized by its unique bicyclic structure, which includes a pyrrole and pyridine moiety. This compound features a methoxy group (-OCH3) at the 4-position of the pyrrole ring and an amino group (-NH2) at the 6-position of the pyridine ring, contributing to its potential biological activity. The presence of these functional groups suggests that it may exhibit properties such as solubility in polar solvents and the ability to participate in hydrogen bonding, which can influence its reactivity and interaction with biological targets. Additionally, the compound's structural features may allow it to act as a ligand in various chemical reactions or as a precursor in the synthesis of more complex molecules. Its specific applications and biological activities would depend on further studies, but compounds of this type are often investigated for their potential in medicinal chemistry and drug development.
Formula:C8H9N3O
InChI:InChI=1S/C8H9N3O/c1-12-6-4-7(9)11-8-5(6)2-3-10-8/h2-4H,1H3,(H3,9,10,11)
InChI key:InChIKey=BHANHUAGCSHNIZ-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(=NC(N)=C1)NC=C2
Synonyms:- 4-Methoxy-1H-pyrrolo[2,3-b]pyridin-6-amine
- 1H-Pyrrolo[2,3-b]pyridin-6-amine, 4-methoxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
