CymitQuimica logo

CAS 1190311-73-9

:

3-Chloro-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one

Description:
3-Chloro-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyrrole and pyridine moieties. The presence of a chlorine atom at the 3-position contributes to its reactivity and potential applications in medicinal chemistry. This compound typically exhibits a range of biological activities, making it of interest in drug discovery and development. Its molecular structure includes a carbonyl group, which can participate in various chemical reactions, enhancing its utility in synthetic organic chemistry. The dihydro form indicates that it has a saturated bond in the bicyclic system, which can influence its physical properties, such as solubility and stability. Additionally, the compound's specific stereochemistry and functional groups can affect its interaction with biological targets, making it a candidate for further research in pharmacology. Overall, 3-Chloro-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one represents a versatile scaffold for the development of novel therapeutic agents.
Formula:C7H5ClN2O
InChI:InChI=1S/C7H5ClN2O/c8-4-3-9-5-1-2-6(11)10-7(4)5/h1-3,9H,(H,10,11)
InChI key:InChIKey=ZLBFJPGHVOLGRP-UHFFFAOYSA-N
SMILES:ClC=1C2=C(C=CC(=O)N2)NC1
Synonyms:
  • 5H-Pyrrolo[3,2-b]pyridin-5-one, 3-chloro-1,4-dihydro-
  • 3-Chloro-1,4-dihydro-5H-pyrrolo[3,2-b]pyridin-5-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.