CymitQuimica logo

CAS 1190311-83-1

:

4-Azido-3-chloro-1H-pyrrolo[2,3-b]pyridine

Description:
4-Azido-3-chloro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic compound characterized by the presence of both azido and chloro functional groups attached to a pyrrolopyridine framework. This compound features a five-membered pyrrole ring fused to a pyridine ring, which contributes to its aromaticity and stability. The azido group (-N3) is known for its reactivity, particularly in click chemistry and as a potential precursor for various nitrogen-containing compounds. The chloro group (-Cl) can participate in nucleophilic substitution reactions, making the compound versatile for further chemical modifications. Its unique structure may impart specific biological activities, making it of interest in medicinal chemistry and material science. Additionally, the compound's properties, such as solubility, melting point, and reactivity, can be influenced by the presence of these functional groups, which may also affect its applications in research and industry. Overall, 4-Azido-3-chloro-1H-pyrrolo[2,3-b]pyridine is a valuable compound for synthetic and applied chemistry.
Formula:C7H4ClN5
InChI:InChI=1S/C7H4ClN5/c8-4-3-11-7-6(4)5(12-13-9)1-2-10-7/h1-3H,(H,10,11)
InChI key:InChIKey=YPKDDMDELGVETG-UHFFFAOYSA-N
SMILES:N(=[N+]=[N-])C1=C2C(NC=C2Cl)=NC=C1
Synonyms:
  • 4-Azido-3-chloro-1H-pyrrolo[2,3-b]pyridine
  • 1H-Pyrrolo[2,3-b]pyridine, 4-azido-3-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.