CymitQuimica logo

CAS 1190311-90-0

:

1H-Pyrrolo[2,3-b]pyridine-3,4-dicarboxaldehyde

Description:
1H-Pyrrolo[2,3-b]pyridine-3,4-dicarboxaldehyde is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. This compound features two aldehyde functional groups located at the 3 and 4 positions of the pyrrolo ring, making it a versatile building block in organic synthesis. The presence of these aldehyde groups allows for various chemical reactions, including condensation and oxidation, facilitating the formation of more complex molecules. The compound is typically solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the compound may serve as a useful intermediate in the synthesis of dyes, agrochemicals, or other functional materials. As with many organic compounds, handling should be done with care, considering potential toxicity and reactivity.
Formula:C9H6N2O2
InChI:InChI=1S/C9H6N2O2/c12-4-6-1-2-10-9-8(6)7(5-13)3-11-9/h1-5H,(H,10,11)
InChI key:InChIKey=JSVQERJAFBDBHS-UHFFFAOYSA-N
SMILES:C(=O)C=1C=2C(NC1)=NC=CC2C=O
Synonyms:
  • 1H-Pyrrolo[2,3-b]pyridine-3,4-dicarboxaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.