CAS 1190312-00-5

Methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

Description:

Methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both a formyl group and a carboxylate ester. This compound typically exhibits a pale to light yellow appearance and is soluble in organic solvents such as ethanol and dimethyl sulfoxide, but may have limited solubility in water. The presence of the formyl group suggests potential reactivity in condensation reactions, while the carboxylate moiety can participate in various chemical transformations, including esterification and nucleophilic substitutions. Its unique structure may confer interesting biological activities, making it a subject of interest in medicinal chemistry and drug development. Additionally, the compound's molecular framework allows for potential interactions with biological targets, which could be explored in pharmacological studies. As with many organic compounds, proper handling and storage are essential to maintain stability and prevent degradation.

Formula: C₁₀H₈N₂O₃

InChI: InChI=1S/C10H8N2O3/c1-15-10(14)7-4-12-9-8(7)6(5-13)2-3-11-9/h2-5H,1H3,(H,11,12)

InChI key: InChIKey=GMDYFQFUCHAYQW-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C=2C(NC1)=NC=CC2C=O

Synonyms:

• 1H-Pyrrolo[2,3-b]pyridine-3-carboxylic acid, 4-formyl-, methyl ester
• Methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

methyl 4-formyl-1H-pyrrolo[2,3-b]pyridine-3-carboxylate

CAS: 1190312-00-5

Formula: C₁₀H₈N₂O₃

Molecular weight: 204.1821

Ref: IN-DA000HJ8