
CAS 1190312-08-3
:3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
Description:
3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of an amino group and an aldehyde functional group enhances its reactivity, making it a potential candidate for various chemical reactions, including condensation and substitution reactions. This compound is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of the amino and aldehyde groups. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the fused ring system can interact with biological targets. Additionally, the compound may exhibit interesting optical and electronic properties, making it of interest in materials science. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde is a versatile compound with potential applications in various fields of chemistry.
Formula:C8H7N3O
InChI:InChI=1S/C8H7N3O/c9-6-3-11-8-7(6)5(4-12)1-2-10-8/h1-4H,9H2,(H,10,11)
InChI key:InChIKey=LENNKEQVJGKAJN-UHFFFAOYSA-N
SMILES:C(=O)C1=C2C(NC=C2N)=NC=C1
Synonyms:- 1H-Pyrrolo[2,3-b]pyridine-4-carboxaldehyde, 3-amino-
- 3-Amino-1H-pyrrolo[2,3-b]pyridine-4-carboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
