CAS 1190312-34-5

3-Nitro-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine

Description:

3-Nitro-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique pyrrolopyridine structure, which incorporates both a nitro group and a trifluoromethyl group. The presence of the nitro group typically imparts polar characteristics, enhancing its reactivity and potential for hydrogen bonding. The trifluoromethyl group contributes to the compound's lipophilicity and can influence its electronic properties, making it a valuable moiety in medicinal chemistry. This compound is likely to exhibit significant biological activity, which may include antimicrobial or anticancer properties, owing to the structural features that are often associated with pharmacological effects. Additionally, its stability and solubility in various solvents can vary, depending on the specific conditions and the presence of functional groups. Overall, 3-Nitro-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine represents a compound of interest in both synthetic and medicinal chemistry, with potential applications in drug development and material science.

Formula: C₈H₄F₃N₃O₂

InChI: InChI=1S/C8H4F3N3O2/c9-8(10,11)6-2-1-4-7(13-6)5(3-12-4)14(15)16/h1-3,12H

InChI key: InChIKey=IPMPQFNRPFPQKZ-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CC=C(C(F)(F)F)N2

Synonyms:

• 1H-Pyrrolo[3,2-b]pyridine, 3-nitro-5-(trifluoromethyl)-
• 3-Nitro-5-(trifluoromethyl)-1H-pyrrolo[3,2-b]pyridine

1H-Pyrrolo[3,2-b]pyridine, 3-nitro-5-(trifluoromethyl)-

CAS: 1190312-34-5

Formula: C₈H₄F₃N₃O₂

Molecular weight: 231.1315

Ref: IN-DA000HIP