CAS 1190312-36-7

6-Fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine

Description:

6-Fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both pyridine and pyrrole moieties. The presence of a fluorine atom at the 6-position and a nitro group at the 3-position contributes to its chemical reactivity and potential biological activity. This compound typically exhibits moderate to high polarity due to the electronegative substituents, influencing its solubility in various solvents. It may participate in electrophilic aromatic substitution reactions, and the nitro group can serve as a functional handle for further chemical modifications. Additionally, compounds of this class are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific interactions of this compound with biological targets can vary, making it of interest in drug discovery and development. Safety and handling precautions should be observed due to the presence of the nitro group, which can be associated with toxicity and environmental concerns.

Formula: C₇H₄FN₃O₂

InChI: InChI=1S/C7H4FN3O2/c8-4-1-5-7(10-2-4)6(3-9-5)11(12)13/h1-3,9H

InChI key: InChIKey=ADZBMEMTYYFHLA-UHFFFAOYSA-N

SMILES: N(=O)(=O)C=1C=2C(NC1)=CC(F)=CN2

Synonyms:

• 6-Fluoro-3-nitro-1H-pyrrolo[3,2-b]pyridine
• 1H-Pyrrolo[3,2-b]pyridine, 6-fluoro-3-nitro-

1H-Pyrrolo[3,2-b]pyridine, 6-fluoro-3-nitro-

CAS: 1190312-36-7

Formula: C₇H₄FN₃O₂

Molecular weight: 181.124

Ref: IN-DA000HIO