CymitQuimica logo

CAS 1190312-40-3

:

3-Iodo-7-methyl-1H-pyrrolo[3,2-b]pyridine

Description:
3-Iodo-7-methyl-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of an iodine atom at the 3-position and a methyl group at the 7-position enhances its reactivity and influences its electronic properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific solvent characteristics. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the biological activity often associated with pyrrole and pyridine derivatives. Additionally, the iodine substituent may facilitate further chemical modifications, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Iodo-7-methyl-1H-pyrrolo[3,2-b]pyridine is of interest for its structural features and potential applications in various chemical fields.
Formula:C8H7IN2
InChI:InChI=1S/C8H7IN2/c1-5-2-3-10-8-6(9)4-11-7(5)8/h2-4,11H,1H3
InChI key:InChIKey=IDSWTOXKAOXKTI-UHFFFAOYSA-N
SMILES:CC1=C2C(C(I)=CN2)=NC=C1
Synonyms:
  • 3-Iodo-7-methyl-1H-pyrrolo[3,2-b]pyridine
  • 1H-Pyrrolo[3,2-b]pyridine, 3-iodo-7-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.