CAS 1190312-48-1
:3-Bromo-7-methyl-1H-pyrrolo[3,2-b]pyridine
Description:
3-Bromo-7-methyl-1H-pyrrolo[3,2-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 3-position and a methyl group at the 7-position enhances its reactivity and solubility in various organic solvents. This compound typically exhibits a pale yellow to brown appearance and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its biological activity. The molecular structure allows for various substitution reactions, making it a versatile intermediate in organic synthesis. Additionally, its heteroatom content can influence its electronic properties, potentially affecting its interaction with biological targets. As with many brominated compounds, it is essential to handle it with care due to potential toxicity and environmental concerns. Overall, 3-Bromo-7-methyl-1H-pyrrolo[3,2-b]pyridine represents an interesting subject for further research in both synthetic and medicinal chemistry.
Formula:C8H7BrN2
InChI:InChI=1S/C8H7BrN2/c1-5-2-3-10-8-6(9)4-11-7(5)8/h2-4,11H,1H3
InChI key:InChIKey=YEUOKOWDEGDZFE-UHFFFAOYSA-N
SMILES:CC1=C2C(C(Br)=CN2)=NC=C1
Synonyms:- 1H-Pyrrolo[3,2-b]pyridine, 3-bromo-7-methyl-
- 3-Bromo-7-methyl-1H-pyrrolo[3,2-b]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
