CAS 1190312-53-8

2-Chloro-6-fluoro-4-nitrobenzothiazole

Description:

2-Chloro-6-fluoro-4-nitrobenzothiazole is a heterocyclic compound characterized by the presence of both a benzothiazole ring and various substituents that influence its chemical properties. The compound features a chlorine atom at the second position, a fluorine atom at the sixth position, and a nitro group at the fourth position of the benzothiazole structure. These substituents contribute to its reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of electronegative atoms like chlorine and fluorine can enhance the compound's lipophilicity and influence its biological activity. Additionally, the nitro group is known for its ability to participate in reduction reactions, making the compound potentially useful in synthetic chemistry. The molecular structure also suggests that it may exhibit interesting electronic properties, which could be exploited in material science or as a precursor in organic synthesis. Overall, 2-Chloro-6-fluoro-4-nitrobenzothiazole is a compound of interest due to its unique structural features and potential applications.

Formula: C₇H₂ClFN₂O₂S

InChI: InChI=1S/C7H2ClFN2O2S/c8-7-10-6-4(11(12)13)1-3(9)2-5(6)14-7/h1-2H

InChI key: InChIKey=PLZDSIZZXUYVNH-UHFFFAOYSA-N

SMILES: N(=O)(=O)C1=C2C(SC(Cl)=N2)=CC(F)=C1

Synonyms:

• 2-Chloro-6-fluoro-4-nitrobenzothiazole
• Benzothiazole, 2-chloro-6-fluoro-4-nitro-