CymitQuimica logo

CAS 1190312-55-0

:

4-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine

Description:
4-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a methyl group at the 4-position of the pyrrole ring influences its reactivity and solubility. This compound typically exhibits basic properties due to the nitrogen atoms in its structure, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. It may also participate in hydrogen bonding due to the amino group, enhancing its interactions in biological systems. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific biological pathways. Its molecular stability and reactivity can be influenced by factors such as pH and solvent polarity. Overall, 4-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine represents a versatile scaffold for further chemical modifications and investigations in drug discovery and development.
Formula:C8H9N3
InChI:InChI=1S/C8H9N3/c1-5-8-6(9)4-11-7(8)2-3-10-5/h2-4,11H,9H2,1H3
InChI key:InChIKey=QJZLMNHTBUJKNH-UHFFFAOYSA-N
SMILES:CC1=C2C(=CC=N1)NC=C2N
Synonyms:
  • 4-Methyl-1H-pyrrolo[3,2-c]pyridin-3-amine
  • 1H-Pyrrolo[3,2-c]pyridin-3-amine, 4-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.